C33H41N5O5 — CID 142548215
methyl N-[(2S)-3-methyl-1-[(2S)-2-[5-(7-nitro-9,9-dipropylfluoren-2-yl)-1H-imidazol-2-yl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate (PubChem CID 142548215) has the molecular formula C33H41N5O5 and a molecular weight of 587.72 g/mol. Its IUPAC name is methyl N-[(2S)-3-methyl-1-[(2S)-2-[5-(7-nitro-9,9-dipropylfluoren-2-yl)-1H-imidazol-2-yl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-3-methyl-1-[(2S)-2-[5-(7-nitro-9,9-dipropylfluoren-2-yl)-1H-imidazol-2-yl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 142548215 |
| Molecular Formula | C33H41N5O5 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.31 |
| IUPAC Name | methyl N-[(2S)-3-methyl-1-[(2S)-2-[5-(7-nitro-9,9-dipropylfluoren-2-yl)-1H-imidazol-2-yl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate |
| SMILES | CCCC1(CCC)c2cc(-c3cnc([C@@H]4CCCN4C(=O)[C@@H](NC(=O)OC)C(C)C)[nH]3)ccc2-c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C33H41N5O5/c1-6-14-33(15-7-2)25-17-21(10-12-23(25)24-13-11-22(38(41)42)18-26(24)33)27-19-34-30(35-27)28-9-8-16-37(28)31(39)29(20(3)4)36-32(40)43-5/h10-13,17-20,28-29H,6-9,14-16H2,1-5H3,(H,34,35)(H,36,40)/t28-,29-/m0/s1 |
| InChIKey | SNSNCHLHTVKWTA-VMPREFPWSA-N |
| XLogP | 6.90 |
| TPSA | 130.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|