C37H51NO5 — CID 142548302
benzyl (2S,4aS,6aR,6aS,6bR,8aR,9S,10E,12aS)-10-hydroxyimino-9-(hydroxymethyl)-2,4a,6a,6b,9,12a-hexamethyl-13-oxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxylate (PubChem CID 142548302) has the molecular formula C37H51NO5 and a molecular weight of 589.82 g/mol. Its IUPAC name is benzyl (2S,4aS,6aR,6aS,6bR,8aR,9S,10E,12aS)-10-hydroxyimino-9-(hydroxymethyl)-2,4a,6a,6b,9,12a-hexamethyl-13-oxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxylate.
| Compound Name | benzyl (2S,4aS,6aR,6aS,6bR,8aR,9S,10E,12aS)-10-hydroxyimino-9-(hydroxymethyl)-2,4a,6a,6b,9,12a-hexamethyl-13-oxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxylate |
|---|---|
| PubChem CID | 142548302 |
| Molecular Formula | C37H51NO5 |
| Molecular Weight | 589.82 g/mol |
| Exact Mass | 589.38 |
| IUPAC Name | benzyl (2S,4aS,6aR,6aS,6bR,8aR,9S,10E,12aS)-10-hydroxyimino-9-(hydroxymethyl)-2,4a,6a,6b,9,12a-hexamethyl-13-oxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxylate |
| SMILES | C[C@]1(C(=O)OCc2ccccc2)CC[C@]2(C)CC[C@]3(C)C(=CC(=O)[C@@H]4[C@@]5(C)CC/C(=N\O)[C@@](C)(CO)[C@@H]5CC[C@]43C)C2C1 |
| InChI | InChI=1S/C37H51NO5/c1-32-16-17-33(2,31(41)43-22-24-10-8-7-9-11-24)21-26(32)25-20-27(40)30-34(3)14-13-29(38-42)35(4,23-39)28(34)12-15-37(30,6)36(25,5)19-18-32/h7-11,20,26,28,30,39,42H,12-19,21-23H2,1-6H3/b38-29+/t26?,28-,30-,32-,33+,34+,35+,36-,37-/m1/s1 |
| InChIKey | QEQRAWATSAXVBB-SKDBWKOWSA-N |
| XLogP | 7.51 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.82 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|