C29H49N — CID 142548488
4-[(2E,4E)-5-(3-ethylcyclohexyl)-3-methylpenta-2,4-dienyl]-N-[(3Z)-hexa-3,5-dien-2-yl]-N,2,5-trimethylcyclohexan-1-amine (PubChem CID 142548488) has the molecular formula C29H49N and a molecular weight of 411.72 g/mol. Its IUPAC name is 4-[(2E,4E)-5-(3-ethylcyclohexyl)-3-methylpenta-2,4-dienyl]-N-[(3Z)-hexa-3,5-dien-2-yl]-N,2,5-trimethylcyclohexan-1-amine.
| Compound Name | 4-[(2E,4E)-5-(3-ethylcyclohexyl)-3-methylpenta-2,4-dienyl]-N-[(3Z)-hexa-3,5-dien-2-yl]-N,2,5-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 142548488 |
| Molecular Formula | C29H49N |
| Molecular Weight | 411.72 g/mol |
| Exact Mass | 411.39 |
| IUPAC Name | 4-[(2E,4E)-5-(3-ethylcyclohexyl)-3-methylpenta-2,4-dienyl]-N-[(3Z)-hexa-3,5-dien-2-yl]-N,2,5-trimethylcyclohexan-1-amine |
| SMILES | C=C/C=C\C(C)N(C)C1CC(C)C(C/C=C(C)/C=C/C2CCCC(CC)C2)CC1C |
| InChI | InChI=1S/C29H49N/c1-8-10-12-25(6)30(7)29-20-23(4)28(19-24(29)5)18-16-22(3)15-17-27-14-11-13-26(9-2)21-27/h8,10,12,15-17,23-29H,1,9,11,13-14,18-21H2,2-7H3/b12-10-,17-15+,22-16+ |
| InChIKey | FNDPJRPJJNODSP-VLVGQPSJSA-N |
| XLogP | 8.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.72 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|