C21H37NO2 — CID 142548504
6-[(2E,4E)-5-(4-ethyloxan-2-yl)-3-methylpenta-2,4-dienyl]-N,2,5-trimethyloxan-3-amine (PubChem CID 142548504) has the molecular formula C21H37NO2 and a molecular weight of 335.53 g/mol. Its IUPAC name is 6-[(2E,4E)-5-(4-ethyloxan-2-yl)-3-methylpenta-2,4-dienyl]-N,2,5-trimethyloxan-3-amine.
| Compound Name | 6-[(2E,4E)-5-(4-ethyloxan-2-yl)-3-methylpenta-2,4-dienyl]-N,2,5-trimethyloxan-3-amine |
|---|---|
| PubChem CID | 142548504 |
| Molecular Formula | C21H37NO2 |
| Molecular Weight | 335.53 g/mol |
| Exact Mass | 335.28 |
| IUPAC Name | 6-[(2E,4E)-5-(4-ethyloxan-2-yl)-3-methylpenta-2,4-dienyl]-N,2,5-trimethyloxan-3-amine |
| SMILES | CCC1CCOC(/C=C/C(C)=C/CC2OC(C)C(NC)CC2C)C1 |
| InChI | InChI=1S/C21H37NO2/c1-6-18-11-12-23-19(14-18)9-7-15(2)8-10-21-16(3)13-20(22-5)17(4)24-21/h7-9,16-22H,6,10-14H2,1-5H3/b9-7+,15-8+ |
| InChIKey | XKXUILDJNQWOFM-KZVYIGENSA-N |
| XLogP | 4.49 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|