About 4-bromo-7-(bromomethyl)-8,9-dihydropyrido[1,2-a]azepine
4-bromo-7-(bromomethyl)-8,9-dihydropyrido[1,2-a]azepine (PubChem CID 142548878) has the molecular formula C11H11Br2N
and a molecular weight of 317.02 g/mol. Its IUPAC name is 4-bromo-7-(bromomethyl)-8,9-dihydropyrido[1,2-a]azepine.
Molecular Properties
| Compound Name | 4-bromo-7-(bromomethyl)-8,9-dihydropyrido[1,2-a]azepine |
| PubChem CID | 142548878 |
| Molecular Formula | C11H11Br2N |
| Molecular Weight | 317.02 g/mol |
| Exact Mass | 314.93 |
| IUPAC Name | 4-bromo-7-(bromomethyl)-8,9-dihydropyrido[1,2-a]azepine |
| SMILES | BrCC1=CN2C(Br)=CC=CC2=CCC1 |
| InChI | InChI=1S/C11H11Br2N/c12-7-9-3-1-4-10-5-2-6-11(13)14(10)8-9/h2,4-6,8H,1,3,7H2 |
| InChIKey | AIWPKUMUCBPMLR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.02 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-7-(bromomethyl)-8,9-dihydropyrido[1,2-a]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-7-(bromomethyl)-8,9-dihydropyrido[1,2-a]azepine?
The IUPAC name of 4-bromo-7-(bromomethyl)-8,9-dihydropyrido[1,2-a]azepine (CID 142548878) is 4-bromo-7-(bromomethyl)-8,9-dihydropyrido[1,2-a]azepine.
What is the SMILES notation for 4-bromo-7-(bromomethyl)-8,9-dihydropyrido[1,2-a]azepine?
The canonical SMILES for 4-bromo-7-(bromomethyl)-8,9-dihydropyrido[1,2-a]azepine is BrCC1=CN2C(Br)=CC=CC2=CCC1.
What is the InChIKey of 4-bromo-7-(bromomethyl)-8,9-dihydropyrido[1,2-a]azepine?
The InChIKey is AIWPKUMUCBPMLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Br2N/c12-7-9-3-1-4-10-5-2-6-11(13)14(10)8-9/h2,4-6,8H,1,3,7H2.
What are the key properties of 4-bromo-7-(bromomethyl)-8,9-dihydropyrido[1,2-a]azepine?
4-bromo-7-(bromomethyl)-8,9-dihydropyrido[1,2-a]azepine has a molecular weight of 317.02 g/mol, XLogP of 4.05, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-7-(bromomethyl)-8,9-dihydropyrido[1,2-a]azepine is sourced from PubChem (CID 142548878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).