C16H37N3O — CID 142549018
N,N-dimethylethanamine;4-piperidin-4-ylmorpholine;propane (PubChem CID 142549018) has the molecular formula C16H37N3O and a molecular weight of 287.49 g/mol. Its IUPAC name is N,N-dimethylethanamine;4-piperidin-4-ylmorpholine;propane.
| Compound Name | N,N-dimethylethanamine;4-piperidin-4-ylmorpholine;propane |
|---|---|
| PubChem CID | 142549018 |
| Molecular Formula | C16H37N3O |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.29 |
| IUPAC Name | N,N-dimethylethanamine;4-piperidin-4-ylmorpholine;propane |
| SMILES | C1CC(N2CCOCC2)CCN1.CCC.CCN(C)C |
| InChI | InChI=1S/C9H18N2O.C4H11N.C3H8/c1-3-10-4-2-9(1)11-5-7-12-8-6-11;1-4-5(2)3;1-3-2/h9-10H,1-8H2;4H2,1-3H3;3H2,1-2H3 |
| InChIKey | ZDWLKOHCGMQTRO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |