C10H12N2 — CID 142549074
3,4,5,6,7,8-hexahydroquinoline-8-carbonitrile (PubChem CID 142549074) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 3,4,5,6,7,8-hexahydroquinoline-8-carbonitrile.
| Compound Name | 3,4,5,6,7,8-hexahydroquinoline-8-carbonitrile |
|---|---|
| PubChem CID | 142549074 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 3,4,5,6,7,8-hexahydroquinoline-8-carbonitrile |
| SMILES | N#CC1CCCC2=C1N=CCC2 |
| InChI | InChI=1S/C10H12N2/c11-7-9-4-1-3-8-5-2-6-12-10(8)9/h6,9H,1-5H2 |
| InChIKey | YKRROCPTUPJVDX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |