About (2S)-4,4-bis[(2,4-dichlorophenyl)methyl]-2-hydroxyoxepan-3-one
(2S)-4,4-bis[(2,4-dichlorophenyl)methyl]-2-hydroxyoxepan-3-one (PubChem CID 142549134) has the molecular formula C20H18Cl4O3
and a molecular weight of 448.17 g/mol. Its IUPAC name is (2S)-4,4-bis[(2,4-dichlorophenyl)methyl]-2-hydroxyoxepan-3-one.
Molecular Properties
| Compound Name | (2S)-4,4-bis[(2,4-dichlorophenyl)methyl]-2-hydroxyoxepan-3-one |
| PubChem CID | 142549134 |
| Molecular Formula | C20H18Cl4O3 |
| Molecular Weight | 448.17 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | (2S)-4,4-bis[(2,4-dichlorophenyl)methyl]-2-hydroxyoxepan-3-one |
| SMILES | O=C1[C@@H](O)OCCCC1(Cc1ccc(Cl)cc1Cl)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H18Cl4O3/c21-14-4-2-12(16(23)8-14)10-20(6-1-7-27-19(26)18(20)25)11-13-3-5-15(22)9-17(13)24/h2-5,8-9,19,26H,1,6-7,10-11H2/t19-/m0/s1 |
| InChIKey | CEXWMLRHQRQBMV-IBGZPJMESA-N |
| XLogP | 5.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.17 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-4,4-bis[(2,4-dichlorophenyl)methyl]-2-hydroxyoxepan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4,4-bis[(2,4-dichlorophenyl)methyl]-2-hydroxyoxepan-3-one?
The IUPAC name of (2S)-4,4-bis[(2,4-dichlorophenyl)methyl]-2-hydroxyoxepan-3-one (CID 142549134) is (2S)-4,4-bis[(2,4-dichlorophenyl)methyl]-2-hydroxyoxepan-3-one.
What is the SMILES notation for (2S)-4,4-bis[(2,4-dichlorophenyl)methyl]-2-hydroxyoxepan-3-one?
The canonical SMILES for (2S)-4,4-bis[(2,4-dichlorophenyl)methyl]-2-hydroxyoxepan-3-one is O=C1[C@@H](O)OCCCC1(Cc1ccc(Cl)cc1Cl)Cc1ccc(Cl)cc1Cl.
What is the InChIKey of (2S)-4,4-bis[(2,4-dichlorophenyl)methyl]-2-hydroxyoxepan-3-one?
The InChIKey is CEXWMLRHQRQBMV-IBGZPJMESA-N. The full InChI is InChI=1S/C20H18Cl4O3/c21-14-4-2-12(16(23)8-14)10-20(6-1-7-27-19(26)18(20)25)11-13-3-5-15(22)9-17(13)24/h2-5,8-9,19,26H,1,6-7,10-11H2/t19-/m0/s1.
What are the key properties of (2S)-4,4-bis[(2,4-dichlorophenyl)methyl]-2-hydroxyoxepan-3-one?
(2S)-4,4-bis[(2,4-dichlorophenyl)methyl]-2-hydroxyoxepan-3-one has a molecular weight of 448.17 g/mol, XLogP of 5.77, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4,4-bis[(2,4-dichlorophenyl)methyl]-2-hydroxyoxepan-3-one is sourced from PubChem (CID 142549134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).