C21H22BClF2N2O3 — CID 142549219
2-(2-chloro-3-pyridinyl)-1-[6,7-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindol-1-yl]ethanone (PubChem CID 142549219) has the molecular formula C21H22BClF2N2O3 and a molecular weight of 434.68 g/mol. Its IUPAC name is 2-(2-chloro-3-pyridinyl)-1-[6,7-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 2-(2-chloro-3-pyridinyl)-1-[6,7-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 142549219 |
| Molecular Formula | C21H22BClF2N2O3 |
| Molecular Weight | 434.68 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 2-(2-chloro-3-pyridinyl)-1-[6,7-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC1(C)OB(c2cc3c(c(F)c2F)N(C(=O)Cc2cccnc2Cl)CC3)OC1(C)C |
| InChI | InChI=1S/C21H22BClF2N2O3/c1-20(2)21(3,4)30-22(29-20)14-10-12-7-9-27(18(12)17(25)16(14)24)15(28)11-13-6-5-8-26-19(13)23/h5-6,8,10H,7,9,11H2,1-4H3 |
| InChIKey | QIQZHFMUSKUOFZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.68 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|