C28H26BFN2O2 — CID 142549323
4-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,6-diphenylpyrimidine (PubChem CID 142549323) has the molecular formula C28H26BFN2O2 and a molecular weight of 452.34 g/mol. Its IUPAC name is 4-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,6-diphenylpyrimidine.
| Compound Name | 4-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 142549323 |
| Molecular Formula | C28H26BFN2O2 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 4-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,6-diphenylpyrimidine |
| SMILES | CC1(C)OB(c2cc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2F)OC1(C)C |
| InChI | InChI=1S/C28H26BFN2O2/c1-27(2)28(3,4)34-29(33-27)22-17-21(15-16-23(22)30)25-18-24(19-11-7-5-8-12-19)31-26(32-25)20-13-9-6-10-14-20/h5-18H,1-4H3 |
| InChIKey | YSGSGYIXJVHOHY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|