C24H41F3O — CID 142549390
1-[(E)-prop-1-enyl]-4-[(E)-3,6,7-trimethyl-10-(trifluoromethoxy)undec-1-enyl]cyclohexane (PubChem CID 142549390) has the molecular formula C24H41F3O and a molecular weight of 402.59 g/mol. Its IUPAC name is 1-[(E)-prop-1-enyl]-4-[(E)-3,6,7-trimethyl-10-(trifluoromethoxy)undec-1-enyl]cyclohexane.
| Compound Name | 1-[(E)-prop-1-enyl]-4-[(E)-3,6,7-trimethyl-10-(trifluoromethoxy)undec-1-enyl]cyclohexane |
|---|---|
| PubChem CID | 142549390 |
| Molecular Formula | C24H41F3O |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | 1-[(E)-prop-1-enyl]-4-[(E)-3,6,7-trimethyl-10-(trifluoromethoxy)undec-1-enyl]cyclohexane |
| SMILES | C/C=C/C1CCC(/C=C/C(C)CCC(C)C(C)CCC(C)OC(F)(F)F)CC1 |
| InChI | InChI=1S/C24H41F3O/c1-6-7-22-14-16-23(17-15-22)13-9-18(2)8-10-19(3)20(4)11-12-21(5)28-24(25,26)27/h6-7,9,13,18-23H,8,10-12,14-17H2,1-5H3/b7-6+,13-9+ |
| InChIKey | FEWVJCCMWUQIAV-WRSMZVRVSA-N |
| XLogP | 8.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|