C14H12FIN2OS2 — CID 142549472
[2-[(4-fluorophenyl)methylsulfanyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]oxy thiohypoiodite (PubChem CID 142549472) has the molecular formula C14H12FIN2OS2 and a molecular weight of 434.30 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methylsulfanyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]oxy thiohypoiodite.
| Compound Name | [2-[(4-fluorophenyl)methylsulfanyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]oxy thiohypoiodite |
|---|---|
| PubChem CID | 142549472 |
| Molecular Formula | C14H12FIN2OS2 |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 433.94 |
| IUPAC Name | [2-[(4-fluorophenyl)methylsulfanyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]oxy thiohypoiodite |
| SMILES | Fc1ccc(CSc2nc3c(c(OSI)n2)CCC3)cc1 |
| InChI | InChI=1S/C14H12FIN2OS2/c15-10-6-4-9(5-7-10)8-20-14-17-12-3-1-2-11(12)13(18-14)19-21-16/h4-7H,1-3,8H2 |
| InChIKey | UGQRLZHOEUQFOZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|