C26H27F3N6O4 — CID 142549530
3-[3-[(1-hydroxy-2-morpholin-4-ylpropyl)amino]-4-(trifluoromethoxy)phenyl]-7-(1-methylpyrazol-4-yl)quinazolin-4-one (PubChem CID 142549530) has the molecular formula C26H27F3N6O4 and a molecular weight of 544.53 g/mol. Its IUPAC name is 3-[3-[(1-hydroxy-2-morpholin-4-ylpropyl)amino]-4-(trifluoromethoxy)phenyl]-7-(1-methylpyrazol-4-yl)quinazolin-4-one.
| Compound Name | 3-[3-[(1-hydroxy-2-morpholin-4-ylpropyl)amino]-4-(trifluoromethoxy)phenyl]-7-(1-methylpyrazol-4-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 142549530 |
| Molecular Formula | C26H27F3N6O4 |
| Molecular Weight | 544.53 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | 3-[3-[(1-hydroxy-2-morpholin-4-ylpropyl)amino]-4-(trifluoromethoxy)phenyl]-7-(1-methylpyrazol-4-yl)quinazolin-4-one |
| SMILES | CC(C(O)Nc1cc(-n2cnc3cc(-c4cnn(C)c4)ccc3c2=O)ccc1OC(F)(F)F)N1CCOCC1 |
| InChI | InChI=1S/C26H27F3N6O4/c1-16(34-7-9-38-10-8-34)24(36)32-22-12-19(4-6-23(22)39-26(27,28)29)35-15-30-21-11-17(3-5-20(21)25(35)37)18-13-31-33(2)14-18/h3-6,11-16,24,32,36H,7-10H2,1-2H3 |
| InChIKey | UKQYJTQJKNYYQD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|