About (3E)-1-ethoxy-5-fluoro-3-(1-methoxyethenyl)hexa-3,5-dien-2-one
(3E)-1-ethoxy-5-fluoro-3-(1-methoxyethenyl)hexa-3,5-dien-2-one (PubChem CID 142549707) has the molecular formula C11H15FO3
and a molecular weight of 214.24 g/mol. Its IUPAC name is (3E)-1-ethoxy-5-fluoro-3-(1-methoxyethenyl)hexa-3,5-dien-2-one.
Molecular Properties
| Compound Name | (3E)-1-ethoxy-5-fluoro-3-(1-methoxyethenyl)hexa-3,5-dien-2-one |
| PubChem CID | 142549707 |
| Molecular Formula | C11H15FO3 |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (3E)-1-ethoxy-5-fluoro-3-(1-methoxyethenyl)hexa-3,5-dien-2-one |
| SMILES | C=C(F)/C=C(\C(=C)OC)C(=O)COCC |
| InChI | InChI=1S/C11H15FO3/c1-5-15-7-11(13)10(6-8(2)12)9(3)14-4/h6H,2-3,5,7H2,1,4H3/b10-6+ |
| InChIKey | CSMPKQSQKYIWRG-UXBLZVDNSA-N |
| XLogP | 2.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-1-ethoxy-5-fluoro-3-(1-methoxyethenyl)hexa-3,5-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-1-ethoxy-5-fluoro-3-(1-methoxyethenyl)hexa-3,5-dien-2-one?
The IUPAC name of (3E)-1-ethoxy-5-fluoro-3-(1-methoxyethenyl)hexa-3,5-dien-2-one (CID 142549707) is (3E)-1-ethoxy-5-fluoro-3-(1-methoxyethenyl)hexa-3,5-dien-2-one.
What is the SMILES notation for (3E)-1-ethoxy-5-fluoro-3-(1-methoxyethenyl)hexa-3,5-dien-2-one?
The canonical SMILES for (3E)-1-ethoxy-5-fluoro-3-(1-methoxyethenyl)hexa-3,5-dien-2-one is C=C(F)/C=C(\C(=C)OC)C(=O)COCC.
What is the InChIKey of (3E)-1-ethoxy-5-fluoro-3-(1-methoxyethenyl)hexa-3,5-dien-2-one?
The InChIKey is CSMPKQSQKYIWRG-UXBLZVDNSA-N. The full InChI is InChI=1S/C11H15FO3/c1-5-15-7-11(13)10(6-8(2)12)9(3)14-4/h6H,2-3,5,7H2,1,4H3/b10-6+.
What are the key properties of (3E)-1-ethoxy-5-fluoro-3-(1-methoxyethenyl)hexa-3,5-dien-2-one?
(3E)-1-ethoxy-5-fluoro-3-(1-methoxyethenyl)hexa-3,5-dien-2-one has a molecular weight of 214.24 g/mol, XLogP of 2.16, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-1-ethoxy-5-fluoro-3-(1-methoxyethenyl)hexa-3,5-dien-2-one is sourced from PubChem (CID 142549707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).