About methoxymethane;6-methyl-5-(trifluoromethyl)pyridine-3-carbaldehyde
methoxymethane;6-methyl-5-(trifluoromethyl)pyridine-3-carbaldehyde (PubChem CID 142549771) has the molecular formula C10H12F3NO2
and a molecular weight of 235.20 g/mol. Its IUPAC name is methoxymethane;6-methyl-5-(trifluoromethyl)pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | methoxymethane;6-methyl-5-(trifluoromethyl)pyridine-3-carbaldehyde |
| PubChem CID | 142549771 |
| Molecular Formula | C10H12F3NO2 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | methoxymethane;6-methyl-5-(trifluoromethyl)pyridine-3-carbaldehyde |
| SMILES | COC.Cc1ncc(C=O)cc1C(F)(F)F |
| InChI | InChI=1S/C8H6F3NO.C2H6O/c1-5-7(8(9,10)11)2-6(4-13)3-12-5;1-3-2/h2-4H,1H3;1-2H3 |
| InChIKey | WFKJDVMSQQILHL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methoxymethane;6-methyl-5-(trifluoromethyl)pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;6-methyl-5-(trifluoromethyl)pyridine-3-carbaldehyde?
The IUPAC name of methoxymethane;6-methyl-5-(trifluoromethyl)pyridine-3-carbaldehyde (CID 142549771) is methoxymethane;6-methyl-5-(trifluoromethyl)pyridine-3-carbaldehyde.
What is the SMILES notation for methoxymethane;6-methyl-5-(trifluoromethyl)pyridine-3-carbaldehyde?
The canonical SMILES for methoxymethane;6-methyl-5-(trifluoromethyl)pyridine-3-carbaldehyde is COC.Cc1ncc(C=O)cc1C(F)(F)F.
What is the InChIKey of methoxymethane;6-methyl-5-(trifluoromethyl)pyridine-3-carbaldehyde?
The InChIKey is WFKJDVMSQQILHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3NO.C2H6O/c1-5-7(8(9,10)11)2-6(4-13)3-12-5;1-3-2/h2-4H,1H3;1-2H3.
What are the key properties of methoxymethane;6-methyl-5-(trifluoromethyl)pyridine-3-carbaldehyde?
methoxymethane;6-methyl-5-(trifluoromethyl)pyridine-3-carbaldehyde has a molecular weight of 235.20 g/mol, XLogP of 2.48, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;6-methyl-5-(trifluoromethyl)pyridine-3-carbaldehyde is sourced from PubChem (CID 142549771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).