C23H34F3NO — CID 142550000
heptane;(2E,4E)-5-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]hepta-2,4,6-trien-2-amine (PubChem CID 142550000) has the molecular formula C23H34F3NO and a molecular weight of 397.53 g/mol. Its IUPAC name is heptane;(2E,4E)-5-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]hepta-2,4,6-trien-2-amine.
| Compound Name | heptane;(2E,4E)-5-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]hepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 142550000 |
| Molecular Formula | C23H34F3NO |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | heptane;(2E,4E)-5-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]hepta-2,4,6-trien-2-amine |
| SMILES | C=C/C(=C\C=C(/C)NCc1cccc(C(F)(F)F)c1)OC.CCCCCCC |
| InChI | InChI=1S/C16H18F3NO.C7H16/c1-4-15(21-3)9-8-12(2)20-11-13-6-5-7-14(10-13)16(17,18)19;1-3-5-7-6-4-2/h4-10,20H,1,11H2,2-3H3;3-7H2,1-2H3/b12-8+,15-9+; |
| InChIKey | YDQNGWPWSDJDLF-PJXZWULRSA-N |
| XLogP | 7.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|