C16H18F3NO — CID 142550001
(2E,4E)-5-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]hepta-2,4,6-trien-2-amine (PubChem CID 142550001) has the molecular formula C16H18F3NO and a molecular weight of 297.32 g/mol. Its IUPAC name is (2E,4E)-5-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]hepta-2,4,6-trien-2-amine.
| Compound Name | (2E,4E)-5-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]hepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 142550001 |
| Molecular Formula | C16H18F3NO |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | (2E,4E)-5-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]hepta-2,4,6-trien-2-amine |
| SMILES | C=C/C(=C\C=C(/C)NCc1cccc(C(F)(F)F)c1)OC |
| InChI | InChI=1S/C16H18F3NO/c1-4-15(21-3)9-8-12(2)20-11-13-6-5-7-14(10-13)16(17,18)19/h4-10,20H,1,11H2,2-3H3/b12-8+,15-9+ |
| InChIKey | NOASBFAJDHORKV-NVXXTVOZSA-N |
| XLogP | 4.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|