About ethane;heptane;N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]propan-2-amine
ethane;heptane;N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]propan-2-amine (PubChem CID 142550077) has the molecular formula C20H41NO
and a molecular weight of 311.55 g/mol. Its IUPAC name is ethane;heptane;N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]propan-2-amine.
Molecular Properties
| Compound Name | ethane;heptane;N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]propan-2-amine |
| PubChem CID | 142550077 |
| Molecular Formula | C20H41NO |
| Molecular Weight | 311.55 g/mol |
| Exact Mass | 311.32 |
| IUPAC Name | ethane;heptane;N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]propan-2-amine |
| SMILES | CC.CCCCCCC.COC1C=CC(CNC(C)C)=CC1 |
| InChI | InChI=1S/C11H19NO.C7H16.C2H6/c1-9(2)12-8-10-4-6-11(13-3)7-5-10;1-3-5-7-6-4-2;1-2/h4-6,9,11-12H,7-8H2,1-3H3;3-7H2,1-2H3;1-2H3 |
| InChIKey | JVSMMYCFTUWQOQ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;heptane;N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;heptane;N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]propan-2-amine?
The IUPAC name of ethane;heptane;N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]propan-2-amine (CID 142550077) is ethane;heptane;N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]propan-2-amine.
What is the SMILES notation for ethane;heptane;N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]propan-2-amine?
The canonical SMILES for ethane;heptane;N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]propan-2-amine is CC.CCCCCCC.COC1C=CC(CNC(C)C)=CC1.
What is the InChIKey of ethane;heptane;N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]propan-2-amine?
The InChIKey is JVSMMYCFTUWQOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO.C7H16.C2H6/c1-9(2)12-8-10-4-6-11(13-3)7-5-10;1-3-5-7-6-4-2;1-2/h4-6,9,11-12H,7-8H2,1-3H3;3-7H2,1-2H3;1-2H3.
What are the key properties of ethane;heptane;N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]propan-2-amine?
ethane;heptane;N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]propan-2-amine has a molecular weight of 311.55 g/mol, XLogP of 5.89, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;heptane;N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]propan-2-amine is sourced from PubChem (CID 142550077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).