C23H39NO — CID 142550090
4-methoxy-N-[(2E)-5-methylhepta-2,6-dienyl]-N-octylcyclohexa-1,5-dien-1-amine (PubChem CID 142550090) has the molecular formula C23H39NO and a molecular weight of 345.57 g/mol. Its IUPAC name is 4-methoxy-N-[(2E)-5-methylhepta-2,6-dienyl]-N-octylcyclohexa-1,5-dien-1-amine.
| Compound Name | 4-methoxy-N-[(2E)-5-methylhepta-2,6-dienyl]-N-octylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 142550090 |
| Molecular Formula | C23H39NO |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 345.30 |
| IUPAC Name | 4-methoxy-N-[(2E)-5-methylhepta-2,6-dienyl]-N-octylcyclohexa-1,5-dien-1-amine |
| SMILES | C=CC(C)C/C=C/CN(CCCCCCCC)C1=CCC(OC)C=C1 |
| InChI | InChI=1S/C23H39NO/c1-5-7-8-9-10-12-19-24(20-13-11-14-21(3)6-2)22-15-17-23(25-4)18-16-22/h6,11,13,15-17,21,23H,2,5,7-10,12,14,18-20H2,1,3-4H3/b13-11+ |
| InChIKey | VRWSEPCSOXWTDF-ACCUITESSA-N |
| XLogP | 6.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|