C21H39NO — CID 14255075
2,6-dimethyl-4-[2-methyl-3-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)propyl]morpholine (PubChem CID 14255075) has the molecular formula C21H39NO and a molecular weight of 321.55 g/mol. Its IUPAC name is 2,6-dimethyl-4-[2-methyl-3-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)propyl]morpholine.
| Compound Name | 2,6-dimethyl-4-[2-methyl-3-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)propyl]morpholine |
|---|---|
| PubChem CID | 14255075 |
| Molecular Formula | C21H39NO |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.30 |
| IUPAC Name | 2,6-dimethyl-4-[2-methyl-3-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)propyl]morpholine |
| SMILES | CC1CCC2CC(CC(C)CN3CC(C)OC(C)C3)CCC2C1 |
| InChI | InChI=1S/C21H39NO/c1-15-5-7-21-11-19(6-8-20(21)10-15)9-16(2)12-22-13-17(3)23-18(4)14-22/h15-21H,5-14H2,1-4H3 |
| InChIKey | DBCILPKGGMZSRT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |