C15H16ClFN2O4 — CID 14255156
2-(4-chloro-2-fluoro-5-methoxyphenyl)-6,8-dimethyl-5,6,8,8a-tetrahydroimidazo[5,1-c][1,4]oxazine-1,3-dione (PubChem CID 14255156) has the molecular formula C15H16ClFN2O4 and a molecular weight of 342.75 g/mol. Its IUPAC name is 2-(4-chloro-2-fluoro-5-methoxyphenyl)-6,8-dimethyl-5,6,8,8a-tetrahydroimidazo[5,1-c][1,4]oxazine-1,3-dione.
| Compound Name | 2-(4-chloro-2-fluoro-5-methoxyphenyl)-6,8-dimethyl-5,6,8,8a-tetrahydroimidazo[5,1-c][1,4]oxazine-1,3-dione |
|---|---|
| PubChem CID | 14255156 |
| Molecular Formula | C15H16ClFN2O4 |
| Molecular Weight | 342.75 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-(4-chloro-2-fluoro-5-methoxyphenyl)-6,8-dimethyl-5,6,8,8a-tetrahydroimidazo[5,1-c][1,4]oxazine-1,3-dione |
| SMILES | COc1cc(N2C(=O)C3C(C)OC(C)CN3C2=O)c(F)cc1Cl |
| InChI | InChI=1S/C15H16ClFN2O4/c1-7-6-18-13(8(2)23-7)14(20)19(15(18)21)11-5-12(22-3)9(16)4-10(11)17/h4-5,7-8,13H,6H2,1-3H3 |
| InChIKey | WLIOHYZNQKTUTK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.75 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|