C13H12ClFN2O3S — CID 14255157
2-(4-chloro-2-fluoro-5-methoxyphenyl)-5,7,8,8a-tetrahydroimidazo[1,5-c][1,3]thiazine-1,3-dione (PubChem CID 14255157) has the molecular formula C13H12ClFN2O3S and a molecular weight of 330.77 g/mol. Its IUPAC name is 2-(4-chloro-2-fluoro-5-methoxyphenyl)-5,7,8,8a-tetrahydroimidazo[1,5-c][1,3]thiazine-1,3-dione.
| Compound Name | 2-(4-chloro-2-fluoro-5-methoxyphenyl)-5,7,8,8a-tetrahydroimidazo[1,5-c][1,3]thiazine-1,3-dione |
|---|---|
| PubChem CID | 14255157 |
| Molecular Formula | C13H12ClFN2O3S |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 2-(4-chloro-2-fluoro-5-methoxyphenyl)-5,7,8,8a-tetrahydroimidazo[1,5-c][1,3]thiazine-1,3-dione |
| SMILES | COc1cc(N2C(=O)C3CCSCN3C2=O)c(F)cc1Cl |
| InChI | InChI=1S/C13H12ClFN2O3S/c1-20-11-5-10(8(15)4-7(11)14)17-12(18)9-2-3-21-6-16(9)13(17)19/h4-5,9H,2-3,6H2,1H3 |
| InChIKey | IRTMXFVQHFQPAH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|