C17H23Cl3O — CID 142551853
methanol;6,7,8-trichloro-1,4a-dimethyl-2,3,4,9,10,10a-hexahydro-1H-phenanthrene (PubChem CID 142551853) has the molecular formula C17H23Cl3O and a molecular weight of 349.73 g/mol. Its IUPAC name is methanol;6,7,8-trichloro-1,4a-dimethyl-2,3,4,9,10,10a-hexahydro-1H-phenanthrene.
| Compound Name | methanol;6,7,8-trichloro-1,4a-dimethyl-2,3,4,9,10,10a-hexahydro-1H-phenanthrene |
|---|---|
| PubChem CID | 142551853 |
| Molecular Formula | C17H23Cl3O |
| Molecular Weight | 349.73 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | methanol;6,7,8-trichloro-1,4a-dimethyl-2,3,4,9,10,10a-hexahydro-1H-phenanthrene |
| SMILES | CC1CCCC2(C)c3cc(Cl)c(Cl)c(Cl)c3CCC12.CO |
| InChI | InChI=1S/C16H19Cl3.CH4O/c1-9-4-3-7-16(2)11(9)6-5-10-12(16)8-13(17)15(19)14(10)18;1-2/h8-9,11H,3-7H2,1-2H3;2H,1H3 |
| InChIKey | XFQGDNDAGWHODG-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.73 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|