About 2-[4-(2,2-dimethylbutoxy)phenyl]sulfanyl-4,5-dimethylpyrimidine
2-[4-(2,2-dimethylbutoxy)phenyl]sulfanyl-4,5-dimethylpyrimidine (PubChem CID 14255207) has the molecular formula C18H24N2OS
and a molecular weight of 316.47 g/mol. Its IUPAC name is 2-[4-(2,2-dimethylbutoxy)phenyl]sulfanyl-4,5-dimethylpyrimidine.
Molecular Properties
| Compound Name | 2-[4-(2,2-dimethylbutoxy)phenyl]sulfanyl-4,5-dimethylpyrimidine |
| PubChem CID | 14255207 |
| Molecular Formula | C18H24N2OS |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 2-[4-(2,2-dimethylbutoxy)phenyl]sulfanyl-4,5-dimethylpyrimidine |
| SMILES | CCC(C)(C)COc1ccc(Sc2ncc(C)c(C)n2)cc1 |
| InChI | InChI=1S/C18H24N2OS/c1-6-18(4,5)12-21-15-7-9-16(10-8-15)22-17-19-11-13(2)14(3)20-17/h7-11H,6,12H2,1-5H3 |
| InChIKey | BWSMTHLZLSNQSK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(2,2-dimethylbutoxy)phenyl]sulfanyl-4,5-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,2-dimethylbutoxy)phenyl]sulfanyl-4,5-dimethylpyrimidine?
The IUPAC name of 2-[4-(2,2-dimethylbutoxy)phenyl]sulfanyl-4,5-dimethylpyrimidine (CID 14255207) is 2-[4-(2,2-dimethylbutoxy)phenyl]sulfanyl-4,5-dimethylpyrimidine.
What is the SMILES notation for 2-[4-(2,2-dimethylbutoxy)phenyl]sulfanyl-4,5-dimethylpyrimidine?
The canonical SMILES for 2-[4-(2,2-dimethylbutoxy)phenyl]sulfanyl-4,5-dimethylpyrimidine is CCC(C)(C)COc1ccc(Sc2ncc(C)c(C)n2)cc1.
What is the InChIKey of 2-[4-(2,2-dimethylbutoxy)phenyl]sulfanyl-4,5-dimethylpyrimidine?
The InChIKey is BWSMTHLZLSNQSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2OS/c1-6-18(4,5)12-21-15-7-9-16(10-8-15)22-17-19-11-13(2)14(3)20-17/h7-11H,6,12H2,1-5H3.
What are the key properties of 2-[4-(2,2-dimethylbutoxy)phenyl]sulfanyl-4,5-dimethylpyrimidine?
2-[4-(2,2-dimethylbutoxy)phenyl]sulfanyl-4,5-dimethylpyrimidine has a molecular weight of 316.47 g/mol, XLogP of 5.06, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,2-dimethylbutoxy)phenyl]sulfanyl-4,5-dimethylpyrimidine is sourced from PubChem (CID 14255207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).