C12H10Cl2N6O2S2 — CID 14255275
N-(2,6-dichlorophenyl)-5,6-dimethyl-7-sulfanylidene-[1,2,4]triazolo[1,5-a][1,3,5]triazine-2-sulfonamide (PubChem CID 14255275) has the molecular formula C12H10Cl2N6O2S2 and a molecular weight of 405.29 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-5,6-dimethyl-7-sulfanylidene-[1,2,4]triazolo[1,5-a][1,3,5]triazine-2-sulfonamide.
| Compound Name | N-(2,6-dichlorophenyl)-5,6-dimethyl-7-sulfanylidene-[1,2,4]triazolo[1,5-a][1,3,5]triazine-2-sulfonamide |
|---|---|
| PubChem CID | 14255275 |
| Molecular Formula | C12H10Cl2N6O2S2 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | N-(2,6-dichlorophenyl)-5,6-dimethyl-7-sulfanylidene-[1,2,4]triazolo[1,5-a][1,3,5]triazine-2-sulfonamide |
| SMILES | Cc1nc2nc(S(=O)(=O)Nc3c(Cl)cccc3Cl)nn2c(=S)n1C |
| InChI | InChI=1S/C12H10Cl2N6O2S2/c1-6-15-10-16-11(17-20(10)12(23)19(6)2)24(21,22)18-9-7(13)4-3-5-8(9)14/h3-5,18H,1-2H3 |
| InChIKey | RXPFZKKQXHCZFD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|