C29H27N5O2 — CID 142552825
ethane;[(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] naphthalene-1-carboximidate (PubChem CID 142552825) has the molecular formula C29H27N5O2 and a molecular weight of 477.57 g/mol. Its IUPAC name is ethane;[(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] naphthalene-1-carboximidate.
| Compound Name | ethane;[(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] naphthalene-1-carboximidate |
|---|---|
| PubChem CID | 142552825 |
| Molecular Formula | C29H27N5O2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | ethane;[(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] naphthalene-1-carboximidate |
| SMILES | CC.[H]/N=C(/O/C(N)=N/C1N=C(c2ccccc2)c2ccccc2NC1=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H21N5O2.C2H6/c28-24(20-15-8-12-17-9-4-5-13-19(17)20)34-27(29)32-25-26(33)30-22-16-7-6-14-21(22)23(31-25)18-10-2-1-3-11-18;1-2/h1-16,25,28H,(H2,29,32)(H,30,33);1-2H3/b28-24+; |
| InChIKey | UFMKPZFTFORVID-YTGAECEWSA-N |
| XLogP | 5.34 |
| TPSA | 112.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|