C30H35N7O3S — CID 142552915
ethane;[(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-cyano-3-morpholin-4-ylthiophene-2-carboximidate (PubChem CID 142552915) has the molecular formula C30H35N7O3S and a molecular weight of 573.72 g/mol. Its IUPAC name is ethane;[(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-cyano-3-morpholin-4-ylthiophene-2-carboximidate.
| Compound Name | ethane;[(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-cyano-3-morpholin-4-ylthiophene-2-carboximidate |
|---|---|
| PubChem CID | 142552915 |
| Molecular Formula | C30H35N7O3S |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | ethane;[(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-cyano-3-morpholin-4-ylthiophene-2-carboximidate |
| SMILES | CC.CC.[H]/N=C(/O/C(N)=N/C1N=C(c2ccccc2)c2ccccc2NC1=O)c1sc(C#N)cc1N1CCOCC1 |
| InChI | InChI=1S/C26H23N7O3S.2C2H6/c27-15-17-14-20(33-10-12-35-13-11-33)22(37-17)23(28)36-26(29)32-24-25(34)30-19-9-5-4-8-18(19)21(31-24)16-6-2-1-3-7-16;2*1-2/h1-9,14,24,28H,10-13H2,(H2,29,32)(H,30,34);2*1-2H3/b28-23+;; |
| InChIKey | DGWRUMWGQUWTOE-AKNWEKGFSA-N |
| XLogP | 4.98 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|