C24H22N6O2S — CID 142553098
ethane;[(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-cyanothiophene-2-carboximidate (PubChem CID 142553098) has the molecular formula C24H22N6O2S and a molecular weight of 458.55 g/mol. Its IUPAC name is ethane;[(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-cyanothiophene-2-carboximidate.
| Compound Name | ethane;[(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-cyanothiophene-2-carboximidate |
|---|---|
| PubChem CID | 142553098 |
| Molecular Formula | C24H22N6O2S |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | ethane;[(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-cyanothiophene-2-carboximidate |
| SMILES | CC.[H]/N=C(/O/C(N)=N/C1N=C(c2ccccc2)c2ccccc2NC1=O)c1ccc(C#N)s1 |
| InChI | InChI=1S/C22H16N6O2S.C2H6/c23-12-14-10-11-17(31-14)19(24)30-22(25)28-20-21(29)26-16-9-5-4-8-15(16)18(27-20)13-6-2-1-3-7-13;1-2/h1-11,20,24H,(H2,25,28)(H,26,29);1-2H3/b24-19+; |
| InChIKey | JDAPIDQOETUDPZ-UUWMJBOLSA-N |
| XLogP | 4.12 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|