C13H21F3N4O3S — CID 142553274
ethane;5-(3-oxomorpholin-4-yl)-2-(trifluoromethyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 142553274) has the molecular formula C13H21F3N4O3S and a molecular weight of 370.40 g/mol. Its IUPAC name is ethane;5-(3-oxomorpholin-4-yl)-2-(trifluoromethyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | ethane;5-(3-oxomorpholin-4-yl)-2-(trifluoromethyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 142553274 |
| Molecular Formula | C13H21F3N4O3S |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | ethane;5-(3-oxomorpholin-4-yl)-2-(trifluoromethyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | CC.CC.NNC(=O)c1nc(C(F)(F)F)sc1N1CCOCC1=O |
| InChI | InChI=1S/C9H9F3N4O3S.2C2H6/c10-9(11,12)8-14-5(6(18)15-13)7(20-8)16-1-2-19-3-4(16)17;2*1-2/h1-3,13H2,(H,15,18);2*1-2H3 |
| InChIKey | FYADZBMYWAQHQD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|