About ethane;methyl 6-(2-formyl-4-nitrophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate
ethane;methyl 6-(2-formyl-4-nitrophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 142554118) has the molecular formula C16H21NO10
and a molecular weight of 387.34 g/mol. Its IUPAC name is ethane;methyl 6-(2-formyl-4-nitrophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate.
Molecular Properties
| Compound Name | ethane;methyl 6-(2-formyl-4-nitrophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate |
| PubChem CID | 142554118 |
| Molecular Formula | C16H21NO10 |
| Molecular Weight | 387.34 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | ethane;methyl 6-(2-formyl-4-nitrophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | CC.COC(=O)C1OC(Oc2ccc([N+](=O)[O-])cc2C=O)C(O)C(O)C1O |
| InChI | InChI=1S/C14H15NO10.C2H6/c1-23-13(20)12-10(18)9(17)11(19)14(25-12)24-8-3-2-7(15(21)22)4-6(8)5-16;1-2/h2-5,9-12,14,17-19H,1H3;1-2H3 |
| InChIKey | KLBWJHZAXNAMDC-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 165.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.34 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl 6-(2-formyl-4-nitrophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 6-(2-formyl-4-nitrophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate?
The IUPAC name of ethane;methyl 6-(2-formyl-4-nitrophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate (CID 142554118) is ethane;methyl 6-(2-formyl-4-nitrophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate.
What is the SMILES notation for ethane;methyl 6-(2-formyl-4-nitrophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate?
The canonical SMILES for ethane;methyl 6-(2-formyl-4-nitrophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate is CC.COC(=O)C1OC(Oc2ccc([N+](=O)[O-])cc2C=O)C(O)C(O)C1O.
What is the InChIKey of ethane;methyl 6-(2-formyl-4-nitrophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate?
The InChIKey is KLBWJHZAXNAMDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO10.C2H6/c1-23-13(20)12-10(18)9(17)11(19)14(25-12)24-8-3-2-7(15(21)22)4-6(8)5-16;1-2/h2-5,9-12,14,17-19H,1H3;1-2H3.
What are the key properties of ethane;methyl 6-(2-formyl-4-nitrophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate?
ethane;methyl 6-(2-formyl-4-nitrophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate has a molecular weight of 387.34 g/mol, XLogP of -0.21, 5 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 6-(2-formyl-4-nitrophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate is sourced from PubChem (CID 142554118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).