C24H38N2O4 — CID 142554661
1-cyclohexa-1,5-dien-1-yloxy-3-[4-[[3-[(3E)-hexa-1,3,5-trien-3-yl]oxy-2-hydroxypropyl]-methylamino]piperidin-1-yl]propan-2-ol (PubChem CID 142554661) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yloxy-3-[4-[[3-[(3E)-hexa-1,3,5-trien-3-yl]oxy-2-hydroxypropyl]-methylamino]piperidin-1-yl]propan-2-ol.
| Compound Name | 1-cyclohexa-1,5-dien-1-yloxy-3-[4-[[3-[(3E)-hexa-1,3,5-trien-3-yl]oxy-2-hydroxypropyl]-methylamino]piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 142554661 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yloxy-3-[4-[[3-[(3E)-hexa-1,3,5-trien-3-yl]oxy-2-hydroxypropyl]-methylamino]piperidin-1-yl]propan-2-ol |
| SMILES | C=C/C=C(\C=C)OCC(O)CN(C)C1CCN(CC(O)COC2=CCCC=C2)CC1 |
| InChI | InChI=1S/C24H38N2O4/c1-4-9-23(5-2)29-18-21(27)16-25(3)20-12-14-26(15-13-20)17-22(28)19-30-24-10-7-6-8-11-24/h4-5,7,9-11,20-22,27-28H,1-2,6,8,12-19H2,3H3/b23-9+ |
| InChIKey | LXHBEIIYFQAIFI-NUGSKGIGSA-N |
| XLogP | 2.63 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|