About 4-[(2-amino-5-nitropyrimidin-4-yl)amino]cyclohexane-1-carboxamide;3-fluorooxane
4-[(2-amino-5-nitropyrimidin-4-yl)amino]cyclohexane-1-carboxamide;3-fluorooxane (PubChem CID 142554664) has the molecular formula C16H25FN6O4
and a molecular weight of 384.41 g/mol. Its IUPAC name is 4-[(2-amino-5-nitropyrimidin-4-yl)amino]cyclohexane-1-carboxamide;3-fluorooxane.
Molecular Properties
| Compound Name | 4-[(2-amino-5-nitropyrimidin-4-yl)amino]cyclohexane-1-carboxamide;3-fluorooxane |
| PubChem CID | 142554664 |
| Molecular Formula | C16H25FN6O4 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 4-[(2-amino-5-nitropyrimidin-4-yl)amino]cyclohexane-1-carboxamide;3-fluorooxane |
| SMILES | FC1CCCOC1.NC(=O)C1CCC(Nc2nc(N)ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C11H16N6O3.C5H9FO/c12-9(18)6-1-3-7(4-2-6)15-10-8(17(19)20)5-14-11(13)16-10;6-5-2-1-3-7-4-5/h5-7H,1-4H2,(H2,12,18)(H3,13,14,15,16);5H,1-4H2 |
| InChIKey | WSPRZMZQUIGHJS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 159.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-amino-5-nitropyrimidin-4-yl)amino]cyclohexane-1-carboxamide;3-fluorooxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-amino-5-nitropyrimidin-4-yl)amino]cyclohexane-1-carboxamide;3-fluorooxane?
The IUPAC name of 4-[(2-amino-5-nitropyrimidin-4-yl)amino]cyclohexane-1-carboxamide;3-fluorooxane (CID 142554664) is 4-[(2-amino-5-nitropyrimidin-4-yl)amino]cyclohexane-1-carboxamide;3-fluorooxane.
What is the SMILES notation for 4-[(2-amino-5-nitropyrimidin-4-yl)amino]cyclohexane-1-carboxamide;3-fluorooxane?
The canonical SMILES for 4-[(2-amino-5-nitropyrimidin-4-yl)amino]cyclohexane-1-carboxamide;3-fluorooxane is FC1CCCOC1.NC(=O)C1CCC(Nc2nc(N)ncc2[N+](=O)[O-])CC1.
What is the InChIKey of 4-[(2-amino-5-nitropyrimidin-4-yl)amino]cyclohexane-1-carboxamide;3-fluorooxane?
The InChIKey is WSPRZMZQUIGHJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N6O3.C5H9FO/c12-9(18)6-1-3-7(4-2-6)15-10-8(17(19)20)5-14-11(13)16-10;6-5-2-1-3-7-4-5/h5-7H,1-4H2,(H2,12,18)(H3,13,14,15,16);5H,1-4H2.
What are the key properties of 4-[(2-amino-5-nitropyrimidin-4-yl)amino]cyclohexane-1-carboxamide;3-fluorooxane?
4-[(2-amino-5-nitropyrimidin-4-yl)amino]cyclohexane-1-carboxamide;3-fluorooxane has a molecular weight of 384.41 g/mol, XLogP of 1.56, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-amino-5-nitropyrimidin-4-yl)amino]cyclohexane-1-carboxamide;3-fluorooxane is sourced from PubChem (CID 142554664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).