C29H25BFN3O2 — CID 142555277
3-(4,6-diphenylpyrimidin-2-yl)-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (PubChem CID 142555277) has the molecular formula C29H25BFN3O2 and a molecular weight of 477.35 g/mol. Its IUPAC name is 3-(4,6-diphenylpyrimidin-2-yl)-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile.
| Compound Name | 3-(4,6-diphenylpyrimidin-2-yl)-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 142555277 |
| Molecular Formula | C29H25BFN3O2 |
| Molecular Weight | 477.35 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 3-(4,6-diphenylpyrimidin-2-yl)-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| SMILES | CC1(C)OB(c2cc(C#N)cc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)c2F)OC1(C)C |
| InChI | InChI=1S/C29H25BFN3O2/c1-28(2)29(3,4)36-30(35-28)23-16-19(18-32)15-22(26(23)31)27-33-24(20-11-7-5-8-12-20)17-25(34-27)21-13-9-6-10-14-21/h5-17H,1-4H3 |
| InChIKey | BDSMILAWSNPFRY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 68.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.35 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|