About ethane;1-methyltriazolo[4,5-c]pyridine
ethane;1-methyltriazolo[4,5-c]pyridine (PubChem CID 142555697) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is ethane;1-methyltriazolo[4,5-c]pyridine.
Molecular Properties
| Compound Name | ethane;1-methyltriazolo[4,5-c]pyridine |
| PubChem CID | 142555697 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | ethane;1-methyltriazolo[4,5-c]pyridine |
| SMILES | CC.Cn1nnc2cnccc21 |
| InChI | InChI=1S/C6H6N4.C2H6/c1-10-6-2-3-7-4-5(6)8-9-10;1-2/h2-4H,1H3;1-2H3 |
| InChIKey | GGGQBMNUPZIHOQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;1-methyltriazolo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyltriazolo[4,5-c]pyridine?
The IUPAC name of ethane;1-methyltriazolo[4,5-c]pyridine (CID 142555697) is ethane;1-methyltriazolo[4,5-c]pyridine.
What is the SMILES notation for ethane;1-methyltriazolo[4,5-c]pyridine?
The canonical SMILES for ethane;1-methyltriazolo[4,5-c]pyridine is CC.Cn1nnc2cnccc21.
What is the InChIKey of ethane;1-methyltriazolo[4,5-c]pyridine?
The InChIKey is GGGQBMNUPZIHOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4.C2H6/c1-10-6-2-3-7-4-5(6)8-9-10;1-2/h2-4H,1H3;1-2H3.
What are the key properties of ethane;1-methyltriazolo[4,5-c]pyridine?
ethane;1-methyltriazolo[4,5-c]pyridine has a molecular weight of 164.21 g/mol, XLogP of 1.39, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyltriazolo[4,5-c]pyridine is sourced from PubChem (CID 142555697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).