About 5-[4-(3-hydroxy-3-methylbutoxy)phenyl]-7-methyl-3H-pyrrolo[3,2-d]pyrimidin-4-one
5-[4-(3-hydroxy-3-methylbutoxy)phenyl]-7-methyl-3H-pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 142556161) has the molecular formula C18H21N3O3
and a molecular weight of 327.38 g/mol. Its IUPAC name is 5-[4-(3-hydroxy-3-methylbutoxy)phenyl]-7-methyl-3H-pyrrolo[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-[4-(3-hydroxy-3-methylbutoxy)phenyl]-7-methyl-3H-pyrrolo[3,2-d]pyrimidin-4-one |
| PubChem CID | 142556161 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 5-[4-(3-hydroxy-3-methylbutoxy)phenyl]-7-methyl-3H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | Cc1cn(-c2ccc(OCCC(C)(C)O)cc2)c2c(=O)[nH]cnc12 |
| InChI | InChI=1S/C18H21N3O3/c1-12-10-21(16-15(12)19-11-20-17(16)22)13-4-6-14(7-5-13)24-9-8-18(2,3)23/h4-7,10-11,23H,8-9H2,1-3H3,(H,19,20,22) |
| InChIKey | ICODZCNOGAKPPH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[4-(3-hydroxy-3-methylbutoxy)phenyl]-7-methyl-3H-pyrrolo[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(3-hydroxy-3-methylbutoxy)phenyl]-7-methyl-3H-pyrrolo[3,2-d]pyrimidin-4-one?
The IUPAC name of 5-[4-(3-hydroxy-3-methylbutoxy)phenyl]-7-methyl-3H-pyrrolo[3,2-d]pyrimidin-4-one (CID 142556161) is 5-[4-(3-hydroxy-3-methylbutoxy)phenyl]-7-methyl-3H-pyrrolo[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 5-[4-(3-hydroxy-3-methylbutoxy)phenyl]-7-methyl-3H-pyrrolo[3,2-d]pyrimidin-4-one?
The canonical SMILES for 5-[4-(3-hydroxy-3-methylbutoxy)phenyl]-7-methyl-3H-pyrrolo[3,2-d]pyrimidin-4-one is Cc1cn(-c2ccc(OCCC(C)(C)O)cc2)c2c(=O)[nH]cnc12.
What is the InChIKey of 5-[4-(3-hydroxy-3-methylbutoxy)phenyl]-7-methyl-3H-pyrrolo[3,2-d]pyrimidin-4-one?
The InChIKey is ICODZCNOGAKPPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O3/c1-12-10-21(16-15(12)19-11-20-17(16)22)13-4-6-14(7-5-13)24-9-8-18(2,3)23/h4-7,10-11,23H,8-9H2,1-3H3,(H,19,20,22).
What are the key properties of 5-[4-(3-hydroxy-3-methylbutoxy)phenyl]-7-methyl-3H-pyrrolo[3,2-d]pyrimidin-4-one?
5-[4-(3-hydroxy-3-methylbutoxy)phenyl]-7-methyl-3H-pyrrolo[3,2-d]pyrimidin-4-one has a molecular weight of 327.38 g/mol, XLogP of 2.56, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(3-hydroxy-3-methylbutoxy)phenyl]-7-methyl-3H-pyrrolo[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 142556161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).