C18H23N3O3 — CID 142556166
ethane;5-[4-(2-methoxyethoxy)phenyl]-7-methyl-3H-pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 142556166) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is ethane;5-[4-(2-methoxyethoxy)phenyl]-7-methyl-3H-pyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | ethane;5-[4-(2-methoxyethoxy)phenyl]-7-methyl-3H-pyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 142556166 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | ethane;5-[4-(2-methoxyethoxy)phenyl]-7-methyl-3H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CC.COCCOc1ccc(-n2cc(C)c3nc[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C16H17N3O3.C2H6/c1-11-9-19(15-14(11)17-10-18-16(15)20)12-3-5-13(6-4-12)22-8-7-21-2;1-2/h3-6,9-10H,7-8H2,1-2H3,(H,17,18,20);1-2H3 |
| InChIKey | NXXVNBVUVODACQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|