C20H31BO5 — CID 142556261
2-[4-[[(3aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane (PubChem CID 142556261) has the molecular formula C20H31BO5 and a molecular weight of 362.28 g/mol. Its IUPAC name is 2-[4-[[(3aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane.
| Compound Name | 2-[4-[[(3aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane |
|---|---|
| PubChem CID | 142556261 |
| Molecular Formula | C20H31BO5 |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | 2-[4-[[(3aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane |
| SMILES | CC.CC1(C)OB(c2ccc(OC3CO[C@H]4CCOC34)cc2)OC1(C)C |
| InChI | InChI=1S/C18H25BO5.C2H6/c1-17(2)18(3,4)24-19(23-17)12-5-7-13(8-6-12)22-15-11-21-14-9-10-20-16(14)15;1-2/h5-8,14-16H,9-11H2,1-4H3;1-2H3/t14-,15?,16?;/m0./s1 |
| InChIKey | DBUPQIQWRBQCGR-UFGPFPEKSA-N |
| XLogP | 2.95 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|