C22H20F4N4OS — CID 142556275
ethenamine;5-(4-fluorophenyl)-7-[3-(trifluoromethyl)phenyl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;methanethiol (PubChem CID 142556275) has the molecular formula C22H20F4N4OS and a molecular weight of 464.49 g/mol. Its IUPAC name is ethenamine;5-(4-fluorophenyl)-7-[3-(trifluoromethyl)phenyl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;methanethiol.
| Compound Name | ethenamine;5-(4-fluorophenyl)-7-[3-(trifluoromethyl)phenyl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;methanethiol |
|---|---|
| PubChem CID | 142556275 |
| Molecular Formula | C22H20F4N4OS |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | ethenamine;5-(4-fluorophenyl)-7-[3-(trifluoromethyl)phenyl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;methanethiol |
| SMILES | C=CN.CS.O=c1[nH]cnc2c1c(-c1ccc(F)cc1)cn2-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H11F4N3O.C2H5N.CH4S/c20-13-6-4-11(5-7-13)15-9-26(17-16(15)18(27)25-10-24-17)14-3-1-2-12(8-14)19(21,22)23;1-2-3;1-2/h1-10H,(H,24,25,27);2H,1,3H2;2H,1H3 |
| InChIKey | XPYGYXDWHQLIKN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|