About 2-(oxolan-2-ylmethyl)-3,4-dihydro-2H-pyran
2-(oxolan-2-ylmethyl)-3,4-dihydro-2H-pyran (PubChem CID 142556609) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethyl)-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 2-(oxolan-2-ylmethyl)-3,4-dihydro-2H-pyran |
| PubChem CID | 142556609 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2-(oxolan-2-ylmethyl)-3,4-dihydro-2H-pyran |
| SMILES | C1=COC(CC2CCCO2)CC1 |
| InChI | InChI=1S/C10H16O2/c1-2-6-11-9(4-1)8-10-5-3-7-12-10/h2,6,9-10H,1,3-5,7-8H2 |
| InChIKey | UPYWPFVXOFBOMI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(oxolan-2-ylmethyl)-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxolan-2-ylmethyl)-3,4-dihydro-2H-pyran?
The IUPAC name of 2-(oxolan-2-ylmethyl)-3,4-dihydro-2H-pyran (CID 142556609) is 2-(oxolan-2-ylmethyl)-3,4-dihydro-2H-pyran.
What is the SMILES notation for 2-(oxolan-2-ylmethyl)-3,4-dihydro-2H-pyran?
The canonical SMILES for 2-(oxolan-2-ylmethyl)-3,4-dihydro-2H-pyran is C1=COC(CC2CCCO2)CC1.
What is the InChIKey of 2-(oxolan-2-ylmethyl)-3,4-dihydro-2H-pyran?
The InChIKey is UPYWPFVXOFBOMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-2-6-11-9(4-1)8-10-5-3-7-12-10/h2,6,9-10H,1,3-5,7-8H2.
What are the key properties of 2-(oxolan-2-ylmethyl)-3,4-dihydro-2H-pyran?
2-(oxolan-2-ylmethyl)-3,4-dihydro-2H-pyran has a molecular weight of 168.24 g/mol, XLogP of 2.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxolan-2-ylmethyl)-3,4-dihydro-2H-pyran is sourced from PubChem (CID 142556609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).