About [2-chloro-5-(3,5-dimethyl-4-nitropyrazol-1-yl)-4-fluorophenyl] methanesulfonate
[2-chloro-5-(3,5-dimethyl-4-nitropyrazol-1-yl)-4-fluorophenyl] methanesulfonate (PubChem CID 14255749) has the molecular formula C12H11ClFN3O5S
and a molecular weight of 363.75 g/mol. Its IUPAC name is [2-chloro-5-(3,5-dimethyl-4-nitropyrazol-1-yl)-4-fluorophenyl] methanesulfonate.
Molecular Properties
| Compound Name | [2-chloro-5-(3,5-dimethyl-4-nitropyrazol-1-yl)-4-fluorophenyl] methanesulfonate |
| PubChem CID | 14255749 |
| Molecular Formula | C12H11ClFN3O5S |
| Molecular Weight | 363.75 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | [2-chloro-5-(3,5-dimethyl-4-nitropyrazol-1-yl)-4-fluorophenyl] methanesulfonate |
| SMILES | Cc1nn(-c2cc(OS(C)(=O)=O)c(Cl)cc2F)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11ClFN3O5S/c1-6-12(17(18)19)7(2)16(15-6)10-5-11(22-23(3,20)21)8(13)4-9(10)14/h4-5H,1-3H3 |
| InChIKey | BTWZQCWPHCTJQD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.75 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-chloro-5-(3,5-dimethyl-4-nitropyrazol-1-yl)-4-fluorophenyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-chloro-5-(3,5-dimethyl-4-nitropyrazol-1-yl)-4-fluorophenyl] methanesulfonate?
The IUPAC name of [2-chloro-5-(3,5-dimethyl-4-nitropyrazol-1-yl)-4-fluorophenyl] methanesulfonate (CID 14255749) is [2-chloro-5-(3,5-dimethyl-4-nitropyrazol-1-yl)-4-fluorophenyl] methanesulfonate.
What is the SMILES notation for [2-chloro-5-(3,5-dimethyl-4-nitropyrazol-1-yl)-4-fluorophenyl] methanesulfonate?
The canonical SMILES for [2-chloro-5-(3,5-dimethyl-4-nitropyrazol-1-yl)-4-fluorophenyl] methanesulfonate is Cc1nn(-c2cc(OS(C)(=O)=O)c(Cl)cc2F)c(C)c1[N+](=O)[O-].
What is the InChIKey of [2-chloro-5-(3,5-dimethyl-4-nitropyrazol-1-yl)-4-fluorophenyl] methanesulfonate?
The InChIKey is BTWZQCWPHCTJQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClFN3O5S/c1-6-12(17(18)19)7(2)16(15-6)10-5-11(22-23(3,20)21)8(13)4-9(10)14/h4-5H,1-3H3.
What are the key properties of [2-chloro-5-(3,5-dimethyl-4-nitropyrazol-1-yl)-4-fluorophenyl] methanesulfonate?
[2-chloro-5-(3,5-dimethyl-4-nitropyrazol-1-yl)-4-fluorophenyl] methanesulfonate has a molecular weight of 363.75 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-chloro-5-(3,5-dimethyl-4-nitropyrazol-1-yl)-4-fluorophenyl] methanesulfonate is sourced from PubChem (CID 14255749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).