C10H13NS — CID 142557918
3-methyl-1,2,3,4-tetrahydroisoquinoline-7-thiol (PubChem CID 142557918) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is 3-methyl-1,2,3,4-tetrahydroisoquinoline-7-thiol.
| Compound Name | 3-methyl-1,2,3,4-tetrahydroisoquinoline-7-thiol |
|---|---|
| PubChem CID | 142557918 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 3-methyl-1,2,3,4-tetrahydroisoquinoline-7-thiol |
| SMILES | CC1Cc2ccc(S)cc2CN1 |
| InChI | InChI=1S/C10H13NS/c1-7-4-8-2-3-10(12)5-9(8)6-11-7/h2-3,5,7,11-12H,4,6H2,1H3 |
| InChIKey | GFALNDVWCNLILW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|