C17H16F3N3O3 — CID 142557935
[(2S,3R,4R)-3-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-3,4-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 142557935) has the molecular formula C17H16F3N3O3 and a molecular weight of 367.33 g/mol. Its IUPAC name is [(2S,3R,4R)-3-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-3,4-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4R)-3-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 142557935 |
| Molecular Formula | C17H16F3N3O3 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | [(2S,3R,4R)-3-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC=C[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1C |
| InChI | InChI=1S/C17H16F3N3O3/c1-9-15(3-4-25-16(9)8-26-10(2)24)23-7-14(21-22-23)11-5-12(18)17(20)13(19)6-11/h3-7,9,15-16H,8H2,1-2H3/t9-,15-,16-/m1/s1 |
| InChIKey | RNHDPTWXJVOZTO-FWGMWULZSA-N |
| XLogP | 3.02 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|