About 2-(3,4-diamino-6,7-dimethylquinolin-2-yl)propan-2-ol
2-(3,4-diamino-6,7-dimethylquinolin-2-yl)propan-2-ol (PubChem CID 142558003) has the molecular formula C14H19N3O
and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-(3,4-diamino-6,7-dimethylquinolin-2-yl)propan-2-ol.
Molecular Properties
| Compound Name | 2-(3,4-diamino-6,7-dimethylquinolin-2-yl)propan-2-ol |
| PubChem CID | 142558003 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 2-(3,4-diamino-6,7-dimethylquinolin-2-yl)propan-2-ol |
| SMILES | Cc1cc2nc(C(C)(C)O)c(N)c(N)c2cc1C |
| InChI | InChI=1S/C14H19N3O/c1-7-5-9-10(6-8(7)2)17-13(14(3,4)18)12(16)11(9)15/h5-6,18H,16H2,1-4H3,(H2,15,17) |
| InChIKey | QGNNXHXZWWBKDN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,4-diamino-6,7-dimethylquinolin-2-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-diamino-6,7-dimethylquinolin-2-yl)propan-2-ol?
The IUPAC name of 2-(3,4-diamino-6,7-dimethylquinolin-2-yl)propan-2-ol (CID 142558003) is 2-(3,4-diamino-6,7-dimethylquinolin-2-yl)propan-2-ol.
What is the SMILES notation for 2-(3,4-diamino-6,7-dimethylquinolin-2-yl)propan-2-ol?
The canonical SMILES for 2-(3,4-diamino-6,7-dimethylquinolin-2-yl)propan-2-ol is Cc1cc2nc(C(C)(C)O)c(N)c(N)c2cc1C.
What is the InChIKey of 2-(3,4-diamino-6,7-dimethylquinolin-2-yl)propan-2-ol?
The InChIKey is QGNNXHXZWWBKDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O/c1-7-5-9-10(6-8(7)2)17-13(14(3,4)18)12(16)11(9)15/h5-6,18H,16H2,1-4H3,(H2,15,17).
What are the key properties of 2-(3,4-diamino-6,7-dimethylquinolin-2-yl)propan-2-ol?
2-(3,4-diamino-6,7-dimethylquinolin-2-yl)propan-2-ol has a molecular weight of 245.33 g/mol, XLogP of 2.24, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-diamino-6,7-dimethylquinolin-2-yl)propan-2-ol is sourced from PubChem (CID 142558003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).