C13H19F2NO3 — CID 142559315
tert-butyl N-[(4E)-5,6-difluoro-1-hydroxy-3-methylidenehepta-4,6-dien-2-yl]carbamate (PubChem CID 142559315) has the molecular formula C13H19F2NO3 and a molecular weight of 275.30 g/mol. Its IUPAC name is tert-butyl N-[(4E)-5,6-difluoro-1-hydroxy-3-methylidenehepta-4,6-dien-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4E)-5,6-difluoro-1-hydroxy-3-methylidenehepta-4,6-dien-2-yl]carbamate |
|---|---|
| PubChem CID | 142559315 |
| Molecular Formula | C13H19F2NO3 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | tert-butyl N-[(4E)-5,6-difluoro-1-hydroxy-3-methylidenehepta-4,6-dien-2-yl]carbamate |
| SMILES | C=C(F)/C(F)=C\C(=C)C(CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H19F2NO3/c1-8(6-10(15)9(2)14)11(7-17)16-12(18)19-13(3,4)5/h6,11,17H,1-2,7H2,3-5H3,(H,16,18)/b10-6+ |
| InChIKey | NVDHPRUGOFISLS-UXBLZVDNSA-N |
| XLogP | 2.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|