C25H25ClF2N8O2 — CID 142559331
1-[1-[4-chloro-3-(1H-1,2,4-triazol-5-yl)phenyl]-2-methoxyethyl]-2-[1-[4-[1-(difluoromethyl)pyrazol-4-yl]phenyl]-2-oxoethyl]-1-methylguanidine (PubChem CID 142559331) has the molecular formula C25H25ClF2N8O2 and a molecular weight of 542.98 g/mol. Its IUPAC name is 1-[1-[4-chloro-3-(1H-1,2,4-triazol-5-yl)phenyl]-2-methoxyethyl]-2-[1-[4-[1-(difluoromethyl)pyrazol-4-yl]phenyl]-2-oxoethyl]-1-methylguanidine.
| Compound Name | 1-[1-[4-chloro-3-(1H-1,2,4-triazol-5-yl)phenyl]-2-methoxyethyl]-2-[1-[4-[1-(difluoromethyl)pyrazol-4-yl]phenyl]-2-oxoethyl]-1-methylguanidine |
|---|---|
| PubChem CID | 142559331 |
| Molecular Formula | C25H25ClF2N8O2 |
| Molecular Weight | 542.98 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | 1-[1-[4-chloro-3-(1H-1,2,4-triazol-5-yl)phenyl]-2-methoxyethyl]-2-[1-[4-[1-(difluoromethyl)pyrazol-4-yl]phenyl]-2-oxoethyl]-1-methylguanidine |
| SMILES | COCC(c1ccc(Cl)c(-c2ncn[nH]2)c1)N(C)/C(N)=N/C(C=O)c1ccc(-c2cnn(C(F)F)c2)cc1 |
| InChI | InChI=1S/C25H25ClF2N8O2/c1-35(22(13-38-2)17-7-8-20(26)19(9-17)23-30-14-31-34-23)25(29)33-21(12-37)16-5-3-15(4-6-16)18-10-32-36(11-18)24(27)28/h3-12,14,21-22,24H,13H2,1-2H3,(H2,29,33)(H,30,31,34) |
| InChIKey | HMJBTQFPHGARRE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.98 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|