C23H22F3NO2 — CID 142559836
ethane;1-[4-[[3-ethynyl-5-(trifluoromethyl)phenyl]methoxy]-2,3-dihydroindol-1-yl]prop-2-en-1-one (PubChem CID 142559836) has the molecular formula C23H22F3NO2 and a molecular weight of 401.43 g/mol. Its IUPAC name is ethane;1-[4-[[3-ethynyl-5-(trifluoromethyl)phenyl]methoxy]-2,3-dihydroindol-1-yl]prop-2-en-1-one.
| Compound Name | ethane;1-[4-[[3-ethynyl-5-(trifluoromethyl)phenyl]methoxy]-2,3-dihydroindol-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 142559836 |
| Molecular Formula | C23H22F3NO2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | ethane;1-[4-[[3-ethynyl-5-(trifluoromethyl)phenyl]methoxy]-2,3-dihydroindol-1-yl]prop-2-en-1-one |
| SMILES | C#Cc1cc(COc2cccc3c2CCN3C(=O)C=C)cc(C(F)(F)F)c1.CC |
| InChI | InChI=1S/C21H16F3NO2.C2H6/c1-3-14-10-15(12-16(11-14)21(22,23)24)13-27-19-7-5-6-18-17(19)8-9-25(18)20(26)4-2;1-2/h1,4-7,10-12H,2,8-9,13H2;1-2H3 |
| InChIKey | TWUPAMKGEZSFDL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|