C9H16ClN3 — CID 142560012
4-chloro-2-N,6-dimethylpyridine-2,3-diamine;ethane (PubChem CID 142560012) has the molecular formula C9H16ClN3 and a molecular weight of 201.70 g/mol. Its IUPAC name is 4-chloro-2-N,6-dimethylpyridine-2,3-diamine;ethane.
| Compound Name | 4-chloro-2-N,6-dimethylpyridine-2,3-diamine;ethane |
|---|---|
| PubChem CID | 142560012 |
| Molecular Formula | C9H16ClN3 |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 4-chloro-2-N,6-dimethylpyridine-2,3-diamine;ethane |
| SMILES | CC.CNc1nc(C)cc(Cl)c1N |
| InChI | InChI=1S/C7H10ClN3.C2H6/c1-4-3-5(8)6(9)7(10-2)11-4;1-2/h3H,9H2,1-2H3,(H,10,11);1-2H3 |
| InChIKey | DLCQGJVCWHYZCO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |