C52H38N6 — CID 142560210
3-carbazol-9-yl-9-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridin-3-ylphenyl]carbazole;ethane (PubChem CID 142560210) has the molecular formula C52H38N6 and a molecular weight of 746.92 g/mol. Its IUPAC name is 3-carbazol-9-yl-9-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridin-3-ylphenyl]carbazole;ethane.
| Compound Name | 3-carbazol-9-yl-9-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridin-3-ylphenyl]carbazole;ethane |
|---|---|
| PubChem CID | 142560210 |
| Molecular Formula | C52H38N6 |
| Molecular Weight | 746.92 g/mol |
| Exact Mass | 746.32 |
| IUPAC Name | 3-carbazol-9-yl-9-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridin-3-ylphenyl]carbazole;ethane |
| SMILES | CC.c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4cccnc4)c(-n4c5ccccc5c5cc(-n6c7ccccc7c7ccccc76)ccc54)c3)n2)cc1 |
| InChI | InChI=1S/C50H32N6.C2H6/c1-3-14-33(15-4-1)48-52-49(34-16-5-2-6-17-34)54-50(53-48)35-25-27-38(36-18-13-29-51-32-36)47(30-35)56-45-24-12-9-21-41(45)42-31-37(26-28-46(42)56)55-43-22-10-7-19-39(43)40-20-8-11-23-44(40)55;1-2/h1-32H;1-2H3 |
| InChIKey | KOXQKCGAYRRRDH-UHFFFAOYSA-N |
| XLogP | 13.15 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.92 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |