C13H23N — CID 142560273
2,3,3,5,5-pentamethylocta-1,7-dien-4-imine (PubChem CID 142560273) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 2,3,3,5,5-pentamethylocta-1,7-dien-4-imine.
| Compound Name | 2,3,3,5,5-pentamethylocta-1,7-dien-4-imine |
|---|---|
| PubChem CID | 142560273 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 2,3,3,5,5-pentamethylocta-1,7-dien-4-imine |
| SMILES | [H]/N=C(\C(C)(C)CC=C)C(C)(C)C(=C)C |
| InChI | InChI=1S/C13H23N/c1-8-9-12(4,5)11(14)13(6,7)10(2)3/h8,14H,1-2,9H2,3-7H3/b14-11+ |
| InChIKey | IODWBTDZGHYMGX-SDNWHVSQSA-N |
| XLogP | 4.21 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|