About ethane;N-[(1Z)-1-isoquinolin-1-ylbuta-1,3-dienyl]ethanimine
ethane;N-[(1Z)-1-isoquinolin-1-ylbuta-1,3-dienyl]ethanimine (PubChem CID 142561391) has the molecular formula C17H20N2
and a molecular weight of 252.36 g/mol. Its IUPAC name is ethane;N-[(1Z)-1-isoquinolin-1-ylbuta-1,3-dienyl]ethanimine.
Molecular Properties
| Compound Name | ethane;N-[(1Z)-1-isoquinolin-1-ylbuta-1,3-dienyl]ethanimine |
| PubChem CID | 142561391 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | ethane;N-[(1Z)-1-isoquinolin-1-ylbuta-1,3-dienyl]ethanimine |
| SMILES | C=C/C=C(\N=C\C)c1nccc2ccccc12.CC |
| InChI | InChI=1S/C15H14N2.C2H6/c1-3-7-14(16-4-2)15-13-9-6-5-8-12(13)10-11-17-15;1-2/h3-11H,1H2,2H3;1-2H3/b14-7-,16-4+; |
| InChIKey | DHYJRPHRTCVBOC-JNRCLLLGSA-N |
| XLogP | 4.88 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[(1Z)-1-isoquinolin-1-ylbuta-1,3-dienyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[(1Z)-1-isoquinolin-1-ylbuta-1,3-dienyl]ethanimine?
The IUPAC name of ethane;N-[(1Z)-1-isoquinolin-1-ylbuta-1,3-dienyl]ethanimine (CID 142561391) is ethane;N-[(1Z)-1-isoquinolin-1-ylbuta-1,3-dienyl]ethanimine.
What is the SMILES notation for ethane;N-[(1Z)-1-isoquinolin-1-ylbuta-1,3-dienyl]ethanimine?
The canonical SMILES for ethane;N-[(1Z)-1-isoquinolin-1-ylbuta-1,3-dienyl]ethanimine is C=C/C=C(\N=C\C)c1nccc2ccccc12.CC.
What is the InChIKey of ethane;N-[(1Z)-1-isoquinolin-1-ylbuta-1,3-dienyl]ethanimine?
The InChIKey is DHYJRPHRTCVBOC-JNRCLLLGSA-N. The full InChI is InChI=1S/C15H14N2.C2H6/c1-3-7-14(16-4-2)15-13-9-6-5-8-12(13)10-11-17-15;1-2/h3-11H,1H2,2H3;1-2H3/b14-7-,16-4+;.
What are the key properties of ethane;N-[(1Z)-1-isoquinolin-1-ylbuta-1,3-dienyl]ethanimine?
ethane;N-[(1Z)-1-isoquinolin-1-ylbuta-1,3-dienyl]ethanimine has a molecular weight of 252.36 g/mol, XLogP of 4.88, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[(1Z)-1-isoquinolin-1-ylbuta-1,3-dienyl]ethanimine is sourced from PubChem (CID 142561391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).